About 9H-carbazole;propane-1,1-diol
9H-carbazole;propane-1,1-diol (PubChem CID 19846299) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is 9H-carbazole;propane-1,1-diol.
Molecular Properties
| Compound Name | 9H-carbazole;propane-1,1-diol |
| PubChem CID | 19846299 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 9H-carbazole;propane-1,1-diol |
| SMILES | CCC(O)O.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C3H8O2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3(4)5/h1-8,13H;3-5H,2H2,1H3 |
| InChIKey | JDJIYNOKYRBALR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazole;propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;propane-1,1-diol?
The IUPAC name of 9H-carbazole;propane-1,1-diol (CID 19846299) is 9H-carbazole;propane-1,1-diol.
What is the SMILES notation for 9H-carbazole;propane-1,1-diol?
The canonical SMILES for 9H-carbazole;propane-1,1-diol is CCC(O)O.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;propane-1,1-diol?
The InChIKey is JDJIYNOKYRBALR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C3H8O2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3(4)5/h1-8,13H;3-5H,2H2,1H3.
What are the key properties of 9H-carbazole;propane-1,1-diol?
9H-carbazole;propane-1,1-diol has a molecular weight of 243.31 g/mol, XLogP of 3.03, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;propane-1,1-diol is sourced from PubChem (CID 19846299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).