About 9H-carbazole;ethane
9H-carbazole;ethane (PubChem CID 91098062) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 9H-carbazole;ethane.
Molecular Properties
| Compound Name | 9H-carbazole;ethane |
| PubChem CID | 91098062 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 9H-carbazole;ethane |
| SMILES | CC.CC.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.2C2H6/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2/h1-8,13H;2*1-2H3 |
| InChIKey | DSQJTPDOXCEVHD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-carbazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;ethane?
The IUPAC name of 9H-carbazole;ethane (CID 91098062) is 9H-carbazole;ethane.
What is the SMILES notation for 9H-carbazole;ethane?
The canonical SMILES for 9H-carbazole;ethane is CC.CC.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;ethane?
The InChIKey is DSQJTPDOXCEVHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.2C2H6/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2/h1-8,13H;2*1-2H3.
What are the key properties of 9H-carbazole;ethane?
9H-carbazole;ethane has a molecular weight of 227.35 g/mol, XLogP of 5.37, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;ethane is sourced from PubChem (CID 91098062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).