C23H27NO3S — CID 56956910
ethyl 6-acetylsulfanyl-2-(benzhydrylideneamino)hexanoate (PubChem CID 56956910) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is ethyl 6-acetylsulfanyl-2-(benzhydrylideneamino)hexanoate.
| Compound Name | ethyl 6-acetylsulfanyl-2-(benzhydrylideneamino)hexanoate |
|---|---|
| PubChem CID | 56956910 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | ethyl 6-acetylsulfanyl-2-(benzhydrylideneamino)hexanoate |
| SMILES | CCOC(=O)C(CCCCSC(C)=O)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO3S/c1-3-27-23(26)21(16-10-11-17-28-18(2)25)24-22(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,21H,3,10-11,16-17H2,1-2H3 |
| InChIKey | ZBFZIWJXMSLYRX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|