C26H27NO2 — CID 22507372
ethyl 2-(benzhydrylideneamino)-3-(3,4-dimethylphenyl)propanoate (PubChem CID 22507372) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is ethyl 2-(benzhydrylideneamino)-3-(3,4-dimethylphenyl)propanoate.
| Compound Name | ethyl 2-(benzhydrylideneamino)-3-(3,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 22507372 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)-3-(3,4-dimethylphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C)c(C)c1)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO2/c1-4-29-26(28)24(18-21-16-15-19(2)20(3)17-21)27-25(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-17,24H,4,18H2,1-3H3 |
| InChIKey | FSPPVLBLXCNSPJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|