C30H29BrNO2P — CID 161376828
methyl (2S)-2-(benzhydrylideneamino)-3-[2-[2-(bromomethyl)phenyl]phenyl]propanoate;phosphane (PubChem CID 161376828) has the molecular formula C30H29BrNO2P and a molecular weight of 546.45 g/mol. Its IUPAC name is methyl (2S)-2-(benzhydrylideneamino)-3-[2-[2-(bromomethyl)phenyl]phenyl]propanoate;phosphane.
| Compound Name | methyl (2S)-2-(benzhydrylideneamino)-3-[2-[2-(bromomethyl)phenyl]phenyl]propanoate;phosphane |
|---|---|
| PubChem CID | 161376828 |
| Molecular Formula | C30H29BrNO2P |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | methyl (2S)-2-(benzhydrylideneamino)-3-[2-[2-(bromomethyl)phenyl]phenyl]propanoate;phosphane |
| SMILES | COC(=O)[C@H](Cc1ccccc1-c1ccccc1CBr)N=C(c1ccccc1)c1ccccc1.P |
| InChI | InChI=1S/C30H26BrNO2.H3P/c1-34-30(33)28(32-29(22-12-4-2-5-13-22)23-14-6-3-7-15-23)20-24-16-8-10-18-26(24)27-19-11-9-17-25(27)21-31;/h2-19,28H,20-21H2,1H3;1H3/t28-;/m0./s1 |
| InChIKey | VRENAGQJWDXZIS-JCOPYZAKSA-N |
| XLogP | 6.93 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|