C26H31NO2Si — CID 10409743
tert-butyl 5-[tert-butyl(diphenyl)silyl]-2-isocyanopent-4-ynoate (PubChem CID 10409743) has the molecular formula C26H31NO2Si and a molecular weight of 417.63 g/mol. Its IUPAC name is tert-butyl 5-[tert-butyl(diphenyl)silyl]-2-isocyanopent-4-ynoate.
| Compound Name | tert-butyl 5-[tert-butyl(diphenyl)silyl]-2-isocyanopent-4-ynoate |
|---|---|
| PubChem CID | 10409743 |
| Molecular Formula | C26H31NO2Si |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | tert-butyl 5-[tert-butyl(diphenyl)silyl]-2-isocyanopent-4-ynoate |
| SMILES | [C-]#[N+]C(CC#C[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H31NO2Si/c1-25(2,3)29-24(28)23(27-7)19-14-20-30(26(4,5)6,21-15-10-8-11-16-21)22-17-12-9-13-18-22/h8-13,15-18,23H,19H2,1-6H3 |
| InChIKey | SBCRATDLOBGIDS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|