C32H47NO4Si2 — CID 54754730
tert-butyl N-[(4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8-trimethylsilyloct-1-en-7-yn-4-yl]carbamate (PubChem CID 54754730) has the molecular formula C32H47NO4Si2 and a molecular weight of 565.90 g/mol. Its IUPAC name is tert-butyl N-[(4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8-trimethylsilyloct-1-en-7-yn-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8-trimethylsilyloct-1-en-7-yn-4-yl]carbamate |
|---|---|
| PubChem CID | 54754730 |
| Molecular Formula | C32H47NO4Si2 |
| Molecular Weight | 565.90 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | tert-butyl N-[(4S,5R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-8-trimethylsilyloct-1-en-7-yn-4-yl]carbamate |
| SMILES | C=CC(O)[C@H](NC(=O)OC(C)(C)C)[C@@H](CC#C[Si](C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H47NO4Si2/c1-11-27(34)29(33-30(35)36-31(2,3)4)28(23-18-24-38(8,9)10)37-39(32(5,6)7,25-19-14-12-15-20-25)26-21-16-13-17-22-26/h11-17,19-22,27-29,34H,1,23H2,2-10H3,(H,33,35)/t27?,28-,29+/m1/s1 |
| InChIKey | CBHXQEQPWIKCBK-WUFLDLQOSA-N |
| XLogP | 5.64 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|