C23H29NO3 — CID 19420331
tert-butyl N-(3-hydroxy-1,1-diphenylhex-5-en-2-yl)carbamate (PubChem CID 19420331) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-(3-hydroxy-1,1-diphenylhex-5-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-hydroxy-1,1-diphenylhex-5-en-2-yl)carbamate |
|---|---|
| PubChem CID | 19420331 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | tert-butyl N-(3-hydroxy-1,1-diphenylhex-5-en-2-yl)carbamate |
| SMILES | C=CCC(O)C(NC(=O)OC(C)(C)C)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-5-12-19(25)21(24-22(26)27-23(2,3)4)20(17-13-8-6-9-14-17)18-15-10-7-11-16-18/h5-11,13-16,19-21,25H,1,12H2,2-4H3,(H,24,26) |
| InChIKey | ONHMBSLCESHCNQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|