C17H18O — CID 11390776
(2S)-1,1-diphenylpent-4-en-2-ol (PubChem CID 11390776) has the molecular formula C17H18O and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S)-1,1-diphenylpent-4-en-2-ol.
| Compound Name | (2S)-1,1-diphenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 11390776 |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (2S)-1,1-diphenylpent-4-en-2-ol |
| SMILES | C=CC[C@H](O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18O/c1-2-9-16(18)17(14-10-5-3-6-11-14)15-12-7-4-8-13-15/h2-8,10-13,16-18H,1,9H2/t16-/m0/s1 |
| InChIKey | MFSVINZOKPVVIQ-INIZCTEOSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|