C20H22 — CID 97429057
[(4S,5S)-5-phenylocta-1,7-dien-4-yl]benzene (PubChem CID 97429057) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is [(4S,5S)-5-phenylocta-1,7-dien-4-yl]benzene.
| Compound Name | [(4S,5S)-5-phenylocta-1,7-dien-4-yl]benzene |
|---|---|
| PubChem CID | 97429057 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [(4S,5S)-5-phenylocta-1,7-dien-4-yl]benzene |
| SMILES | C=CC[C@H](c1ccccc1)[C@H](CC=C)c1ccccc1 |
| InChI | InChI=1S/C20H22/c1-3-11-19(17-13-7-5-8-14-17)20(12-4-2)18-15-9-6-10-16-18/h3-10,13-16,19-20H,1-2,11-12H2/t19-,20-/m1/s1 |
| InChIKey | ICHCZSRMJBBXSJ-WOJBJXKFSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|