About (3S)-3-phenylhex-5-enal
(3S)-3-phenylhex-5-enal (PubChem CID 11229081) has the molecular formula C12H14O
and a molecular weight of 174.24 g/mol. Its IUPAC name is (3S)-3-phenylhex-5-enal.
Molecular Properties
| Compound Name | (3S)-3-phenylhex-5-enal |
| PubChem CID | 11229081 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (3S)-3-phenylhex-5-enal |
| SMILES | C=CC[C@@H](CC=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O/c1-2-6-11(9-10-13)12-7-4-3-5-8-12/h2-5,7-8,10-11H,1,6,9H2/t11-/m0/s1 |
| InChIKey | ILWRILOEOPNHBF-NSHDSACASA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-phenylhex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-phenylhex-5-enal?
The IUPAC name of (3S)-3-phenylhex-5-enal (CID 11229081) is (3S)-3-phenylhex-5-enal.
What is the SMILES notation for (3S)-3-phenylhex-5-enal?
The canonical SMILES for (3S)-3-phenylhex-5-enal is C=CC[C@@H](CC=O)c1ccccc1.
What is the InChIKey of (3S)-3-phenylhex-5-enal?
The InChIKey is ILWRILOEOPNHBF-NSHDSACASA-N. The full InChI is InChI=1S/C12H14O/c1-2-6-11(9-10-13)12-7-4-3-5-8-12/h2-5,7-8,10-11H,1,6,9H2/t11-/m0/s1.
What are the key properties of (3S)-3-phenylhex-5-enal?
(3S)-3-phenylhex-5-enal has a molecular weight of 174.24 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-phenylhex-5-enal is sourced from PubChem (CID 11229081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).