C13H16O — CID 102328928
(E,3R)-3-phenylhept-5-enal (PubChem CID 102328928) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (E,3R)-3-phenylhept-5-enal.
| Compound Name | (E,3R)-3-phenylhept-5-enal |
|---|---|
| PubChem CID | 102328928 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (E,3R)-3-phenylhept-5-enal |
| SMILES | C/C=C/C[C@H](CC=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-2-3-7-13(10-11-14)12-8-5-4-6-9-12/h2-6,8-9,11,13H,7,10H2,1H3/b3-2+/t13-/m1/s1 |
| InChIKey | CZHUQVJEJXUBMD-YWVDXFKGSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|