C19H18O2 — CID 134950944
(E,3R)-7-oxo-3,7-diphenylhept-5-enal (PubChem CID 134950944) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is (E,3R)-7-oxo-3,7-diphenylhept-5-enal.
| Compound Name | (E,3R)-7-oxo-3,7-diphenylhept-5-enal |
|---|---|
| PubChem CID | 134950944 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E,3R)-7-oxo-3,7-diphenylhept-5-enal |
| SMILES | O=CC[C@@H](C/C=C/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O2/c20-15-14-17(16-8-3-1-4-9-16)12-7-13-19(21)18-10-5-2-6-11-18/h1-11,13,15,17H,12,14H2/b13-7+/t17-/m1/s1 |
| InChIKey | UAYGHLPWPDDUSZ-SDSFWRRZSA-N |
| XLogP | 4.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|