About 4-nitro-3-phenylbutanal
4-nitro-3-phenylbutanal (PubChem CID 75046041) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is 4-nitro-3-phenylbutanal.
Molecular Properties
| Compound Name | 4-nitro-3-phenylbutanal |
| PubChem CID | 75046041 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-nitro-3-phenylbutanal |
| SMILES | O=CCC(C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C10H11NO3/c12-7-6-10(8-11(13)14)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2 |
| InChIKey | NMYRRLFCAWZDAL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-3-phenylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-3-phenylbutanal?
The IUPAC name of 4-nitro-3-phenylbutanal (CID 75046041) is 4-nitro-3-phenylbutanal.
What is the SMILES notation for 4-nitro-3-phenylbutanal?
The canonical SMILES for 4-nitro-3-phenylbutanal is O=CCC(C[N+](=O)[O-])c1ccccc1.
What is the InChIKey of 4-nitro-3-phenylbutanal?
The InChIKey is NMYRRLFCAWZDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c12-7-6-10(8-11(13)14)9-4-2-1-3-5-9/h1-5,7,10H,6,8H2.
What are the key properties of 4-nitro-3-phenylbutanal?
4-nitro-3-phenylbutanal has a molecular weight of 193.20 g/mol, XLogP of 1.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-3-phenylbutanal is sourced from PubChem (CID 75046041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).