About (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane
(3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane (PubChem CID 159653102) has the molecular formula C10H12FNO3S
and a molecular weight of 245.27 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane.
Molecular Properties
| Compound Name | (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane |
| PubChem CID | 159653102 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane |
| SMILES | O=CC[C@H](C[N+](=O)[O-])c1ccc(F)cc1.S |
| InChI | InChI=1S/C10H10FNO3.H2S/c11-10-3-1-8(2-4-10)9(5-6-13)7-12(14)15;/h1-4,6,9H,5,7H2;1H2/t9-;/m1./s1 |
| InChIKey | MRVCNPJREBQIGF-SBSPUUFOSA-N |
| XLogP | 1.89 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane?
The IUPAC name of (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane (CID 159653102) is (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane.
What is the SMILES notation for (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane?
The canonical SMILES for (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane is O=CC[C@H](C[N+](=O)[O-])c1ccc(F)cc1.S.
What is the InChIKey of (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane?
The InChIKey is MRVCNPJREBQIGF-SBSPUUFOSA-N. The full InChI is InChI=1S/C10H10FNO3.H2S/c11-10-3-1-8(2-4-10)9(5-6-13)7-12(14)15;/h1-4,6,9H,5,7H2;1H2/t9-;/m1./s1.
What are the key properties of (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane?
(3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane has a molecular weight of 245.27 g/mol, XLogP of 1.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(4-fluorophenyl)-4-nitrobutanal;sulfane is sourced from PubChem (CID 159653102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).