C17H15ClFNO3 — CID 124677233
(2R,3R)-2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-nitrobutanal (PubChem CID 124677233) has the molecular formula C17H15ClFNO3 and a molecular weight of 335.76 g/mol. Its IUPAC name is (2R,3R)-2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-nitrobutanal.
| Compound Name | (2R,3R)-2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-nitrobutanal |
|---|---|
| PubChem CID | 124677233 |
| Molecular Formula | C17H15ClFNO3 |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | (2R,3R)-2-[(3-chlorophenyl)methyl]-3-(4-fluorophenyl)-4-nitrobutanal |
| SMILES | O=C[C@H](Cc1cccc(Cl)c1)[C@@H](C[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15ClFNO3/c18-15-3-1-2-12(9-15)8-14(11-21)17(10-20(22)23)13-4-6-16(19)7-5-13/h1-7,9,11,14,17H,8,10H2/t14-,17-/m0/s1 |
| InChIKey | DBGVLPSVYJPYAN-YOEHRIQHSA-N |
| XLogP | 3.90 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|