C15H18F3NO5 — CID 124677183
(2R,3S)-4,4-dimethoxy-3-(nitromethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]butanal (PubChem CID 124677183) has the molecular formula C15H18F3NO5 and a molecular weight of 349.31 g/mol. Its IUPAC name is (2R,3S)-4,4-dimethoxy-3-(nitromethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]butanal.
| Compound Name | (2R,3S)-4,4-dimethoxy-3-(nitromethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]butanal |
|---|---|
| PubChem CID | 124677183 |
| Molecular Formula | C15H18F3NO5 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2R,3S)-4,4-dimethoxy-3-(nitromethyl)-2-[[3-(trifluoromethyl)phenyl]methyl]butanal |
| SMILES | COC(OC)[C@H](C[N+](=O)[O-])[C@H](C=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NO5/c1-23-14(24-2)13(8-19(21)22)11(9-20)6-10-4-3-5-12(7-10)15(16,17)18/h3-5,7,9,11,13-14H,6,8H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | RHGZZTIVQPFZMP-WCQYABFASA-N |
| XLogP | 2.57 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|