C12H15F3O2 — CID 79617375
3-methoxy-1-[3-(trifluoromethyl)phenyl]butan-2-ol (PubChem CID 79617375) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 3-methoxy-1-[3-(trifluoromethyl)phenyl]butan-2-ol.
| Compound Name | 3-methoxy-1-[3-(trifluoromethyl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 79617375 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-methoxy-1-[3-(trifluoromethyl)phenyl]butan-2-ol |
| SMILES | COC(C)C(O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O2/c1-8(17-2)11(16)7-9-4-3-5-10(6-9)12(13,14)15/h3-6,8,11,16H,7H2,1-2H3 |
| InChIKey | HHQJSZXMVUFPSV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |