C16H13ClFNO3 — CID 124677145
(2S,3S)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-4-nitrobutanal (PubChem CID 124677145) has the molecular formula C16H13ClFNO3 and a molecular weight of 321.74 g/mol. Its IUPAC name is (2S,3S)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-4-nitrobutanal.
| Compound Name | (2S,3S)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-4-nitrobutanal |
|---|---|
| PubChem CID | 124677145 |
| Molecular Formula | C16H13ClFNO3 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | (2S,3S)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-4-nitrobutanal |
| SMILES | O=C[C@H](c1ccccc1Cl)[C@H](C[N+](=O)[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13ClFNO3/c17-16-4-2-1-3-13(16)15(10-20)14(9-19(21)22)11-5-7-12(18)8-6-11/h1-8,10,14-15H,9H2/t14-,15-/m1/s1 |
| InChIKey | FUBDHRIOOXKWOZ-HUUCEWRRSA-N |
| XLogP | 3.82 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|