C46H36Cl2N2O8 — CID 139180906
2-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 139180906) has the molecular formula C46H36Cl2N2O8 and a molecular weight of 815.71 g/mol. Its IUPAC name is 2-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 139180906 |
| Molecular Formula | C46H36Cl2N2O8 |
| Molecular Weight | 815.71 g/mol |
| Exact Mass | 814.18 |
| IUPAC Name | 2-[(1S)-1-(4-chlorophenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(Cl)cc1.O=C(c1ccccc1)C(C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C23H18ClNO4/c2*24-19-13-11-16(12-14-19)20(15-25(28)29)21(22(26)17-7-3-1-4-8-17)23(27)18-9-5-2-6-10-18/h2*1-14,20-21H,15H2/t2*20-/m11/s1 |
| InChIKey | VARKMDWFUDCVKW-DKGNBFFWSA-N |
| XLogP | 10.16 |
| TPSA | 154.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.71 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|