C21H17NO4S — CID 154708487
2-[(1S)-2-nitro-1-thiophen-2-ylethyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 154708487) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[(1S)-2-nitro-1-thiophen-2-ylethyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(1S)-2-nitro-1-thiophen-2-ylethyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 154708487 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[(1S)-2-nitro-1-thiophen-2-ylethyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)[C@@H](C[N+](=O)[O-])c1cccs1 |
| InChI | InChI=1S/C21H17NO4S/c23-20(15-8-3-1-4-9-15)19(21(24)16-10-5-2-6-11-16)17(14-22(25)26)18-12-7-13-27-18/h1-13,17,19H,14H2/t17-/m0/s1 |
| InChIKey | RZZSSHRHWXLEGE-KRWDZBQOSA-N |
| XLogP | 4.49 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|