C27H21NO4 — CID 56592577
2-[(1S)-1-naphthalen-1-yl-2-nitroethyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 56592577) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[(1S)-1-naphthalen-1-yl-2-nitroethyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(1S)-1-naphthalen-1-yl-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 56592577 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[(1S)-1-naphthalen-1-yl-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1cccc2ccccc12 |
| InChI | InChI=1S/C27H21NO4/c29-26(20-11-3-1-4-12-20)25(27(30)21-13-5-2-6-14-21)24(18-28(31)32)23-17-9-15-19-10-7-8-16-22(19)23/h1-17,24-25H,18H2/t24-/m1/s1 |
| InChIKey | YXPDDZZSYOWANK-XMMPIXPASA-N |
| XLogP | 5.58 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|