C29H27NO3 — CID 54770120
(2R,3R)-3-naphthalen-1-yl-2-[(1S)-2-nitro-1-phenylethyl]-1-phenylpentan-1-one (PubChem CID 54770120) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2R,3R)-3-naphthalen-1-yl-2-[(1S)-2-nitro-1-phenylethyl]-1-phenylpentan-1-one.
| Compound Name | (2R,3R)-3-naphthalen-1-yl-2-[(1S)-2-nitro-1-phenylethyl]-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 54770120 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (2R,3R)-3-naphthalen-1-yl-2-[(1S)-2-nitro-1-phenylethyl]-1-phenylpentan-1-one |
| SMILES | CC[C@@H](c1cccc2ccccc12)[C@@H](C(=O)c1ccccc1)[C@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C29H27NO3/c1-2-24(26-19-11-17-21-14-9-10-18-25(21)26)28(29(31)23-15-7-4-8-16-23)27(20-30(32)33)22-12-5-3-6-13-22/h3-19,24,27-28H,2,20H2,1H3/t24-,27+,28+/m0/s1 |
| InChIKey | RZXUJOAHVBMZON-HNPKZYAISA-N |
| XLogP | 6.89 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|