C25H19NO4 — CID 56592666
2-[(1S)-1-(2-ethynylphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 56592666) has the molecular formula C25H19NO4 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[(1S)-1-(2-ethynylphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(1S)-1-(2-ethynylphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 56592666 |
| Molecular Formula | C25H19NO4 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[(1S)-1-(2-ethynylphenyl)-2-nitroethyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | C#Cc1ccccc1[C@@H](C[N+](=O)[O-])C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H19NO4/c1-2-18-11-9-10-16-21(18)22(17-26(29)30)23(24(27)19-12-5-3-6-13-19)25(28)20-14-7-4-8-15-20/h1,3-16,22-23H,17H2/t22-/m1/s1 |
| InChIKey | IIQUOSWIFITXOE-JOCHJYFZSA-N |
| XLogP | 4.41 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|