C30H22O4 — CID 4277936
2,3-dibenzoyl-1,4-diphenylbutane-1,4-dione (PubChem CID 4277936) has the molecular formula C30H22O4 and a molecular weight of 446.50 g/mol. Its IUPAC name is 2,3-dibenzoyl-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2,3-dibenzoyl-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 4277936 |
| Molecular Formula | C30H22O4 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 2,3-dibenzoyl-1,4-diphenylbutane-1,4-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H22O4/c31-27(21-13-5-1-6-14-21)25(28(32)22-15-7-2-8-16-22)26(29(33)23-17-9-3-10-18-23)30(34)24-19-11-4-12-20-24/h1-20,25-26H |
| InChIKey | QPKVOOSJCFCEGP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|