C45H33AlO6 — CID 177391410
2-bis(1,3-dioxo-1,3-diphenylpropan-2-yl)alumanyl-1,3-diphenylpropane-1,3-dione (PubChem CID 177391410) has the molecular formula C45H33AlO6 and a molecular weight of 696.74 g/mol. Its IUPAC name is 2-bis(1,3-dioxo-1,3-diphenylpropan-2-yl)alumanyl-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-bis(1,3-dioxo-1,3-diphenylpropan-2-yl)alumanyl-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 177391410 |
| Molecular Formula | C45H33AlO6 |
| Molecular Weight | 696.74 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 2-bis(1,3-dioxo-1,3-diphenylpropan-2-yl)alumanyl-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(C(=O)c1ccccc1)[Al](C(C(=O)c1ccccc1)C(=O)c1ccccc1)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/3C15H11O2.Al/c3*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;/h3*1-11H; |
| InChIKey | KODOWFUFIINMKH-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.74 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|