C10H9F3O3 — CID 20709916
4,4,4-trifluoro-2,3-dihydroxy-1-phenylbutan-1-one (PubChem CID 20709916) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is 4,4,4-trifluoro-2,3-dihydroxy-1-phenylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-2,3-dihydroxy-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 20709916 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4,4,4-trifluoro-2,3-dihydroxy-1-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(O)C(O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O3/c11-10(12,13)9(16)8(15)7(14)6-4-2-1-3-5-6/h1-5,8-9,15-16H |
| InChIKey | DOGQAIAIZJFNOV-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |