C11H7F7O2 — CID 101051486
3,3,4,4,5,5,5-heptafluoro-2-hydroxy-1-phenylpentan-1-one (PubChem CID 101051486) has the molecular formula C11H7F7O2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoro-2-hydroxy-1-phenylpentan-1-one.
| Compound Name | 3,3,4,4,5,5,5-heptafluoro-2-hydroxy-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 101051486 |
| Molecular Formula | C11H7F7O2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoro-2-hydroxy-1-phenylpentan-1-one |
| SMILES | O=C(c1ccccc1)C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F7O2/c12-9(13,10(14,15)11(16,17)18)8(20)7(19)6-4-2-1-3-5-6/h1-5,8,20H |
| InChIKey | IZVISWITXMHFCC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|