C10H8F3IO3 — CID 135045219
4,4,4-trifluoro-3,3-dihydroxy-2-iodo-1-phenylbutan-1-one (PubChem CID 135045219) has the molecular formula C10H8F3IO3 and a molecular weight of 360.07 g/mol. Its IUPAC name is 4,4,4-trifluoro-3,3-dihydroxy-2-iodo-1-phenylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-3,3-dihydroxy-2-iodo-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 135045219 |
| Molecular Formula | C10H8F3IO3 |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 4,4,4-trifluoro-3,3-dihydroxy-2-iodo-1-phenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(I)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H8F3IO3/c11-10(12,13)9(16,17)8(14)7(15)6-4-2-1-3-5-6/h1-5,8,16-17H |
| InChIKey | VZNWKTBKHOQPAD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|