C13H16F3NO2 — CID 23290079
3-amino-4,4,4-trifluoro-3-hydroxy-1-phenyl-2-propan-2-ylbutan-1-one (PubChem CID 23290079) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-3-hydroxy-1-phenyl-2-propan-2-ylbutan-1-one.
| Compound Name | 3-amino-4,4,4-trifluoro-3-hydroxy-1-phenyl-2-propan-2-ylbutan-1-one |
|---|---|
| PubChem CID | 23290079 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-3-hydroxy-1-phenyl-2-propan-2-ylbutan-1-one |
| SMILES | CC(C)C(C(=O)c1ccccc1)C(N)(O)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2/c1-8(2)10(12(17,19)13(14,15)16)11(18)9-6-4-3-5-7-9/h3-8,10,19H,17H2,1-2H3 |
| InChIKey | ZAOAFNUEEOJVCU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|