C12H10F6O — CID 139779383
3,3,4,5,5,5-hexafluoro-2-methyl-1-phenylpentan-1-one (PubChem CID 139779383) has the molecular formula C12H10F6O and a molecular weight of 284.20 g/mol. Its IUPAC name is 3,3,4,5,5,5-hexafluoro-2-methyl-1-phenylpentan-1-one.
| Compound Name | 3,3,4,5,5,5-hexafluoro-2-methyl-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 139779383 |
| Molecular Formula | C12H10F6O |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3,3,4,5,5,5-hexafluoro-2-methyl-1-phenylpentan-1-one |
| SMILES | CC(C(=O)c1ccccc1)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F6O/c1-7(9(19)8-5-3-2-4-6-8)11(14,15)10(13)12(16,17)18/h2-7,10H,1H3 |
| InChIKey | VQNKBVUFZQVPKT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |