C13H15F3O — CID 54076054
5,5,5-trifluoro-2,4-dimethyl-1-phenylpentan-1-one (PubChem CID 54076054) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is 5,5,5-trifluoro-2,4-dimethyl-1-phenylpentan-1-one.
| Compound Name | 5,5,5-trifluoro-2,4-dimethyl-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 54076054 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5,5,5-trifluoro-2,4-dimethyl-1-phenylpentan-1-one |
| SMILES | CC(CC(C)C(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15F3O/c1-9(8-10(2)13(14,15)16)12(17)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | MJTBGTTYNPZVMA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |