C10H7F5O3 — CID 102198852
2,4,4,4-tetrafluoro-1-(4-fluorophenyl)-3,3-dihydroxybutan-1-one (PubChem CID 102198852) has the molecular formula C10H7F5O3 and a molecular weight of 270.15 g/mol. Its IUPAC name is 2,4,4,4-tetrafluoro-1-(4-fluorophenyl)-3,3-dihydroxybutan-1-one.
| Compound Name | 2,4,4,4-tetrafluoro-1-(4-fluorophenyl)-3,3-dihydroxybutan-1-one |
|---|---|
| PubChem CID | 102198852 |
| Molecular Formula | C10H7F5O3 |
| Molecular Weight | 270.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2,4,4,4-tetrafluoro-1-(4-fluorophenyl)-3,3-dihydroxybutan-1-one |
| SMILES | O=C(c1ccc(F)cc1)C(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H7F5O3/c11-6-3-1-5(2-4-6)7(16)8(12)9(17,18)10(13,14)15/h1-4,8,17-18H |
| InChIKey | MZMGNOAJENOUCU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|