C10H6F4O2 — CID 2771476
4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione (PubChem CID 2771476) has the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 2771476 |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-fluorophenyl)butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H6F4O2/c11-7-3-1-6(2-4-7)8(15)5-9(16)10(12,13)14/h1-4H,5H2 |
| InChIKey | KEZLARPKXOHKJS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|