C15H13IO2 — CID 11360131
(2R,3R)-3-hydroxy-2-iodo-1,3-diphenylpropan-1-one (PubChem CID 11360131) has the molecular formula C15H13IO2 and a molecular weight of 352.17 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2-iodo-1,3-diphenylpropan-1-one.
| Compound Name | (2R,3R)-3-hydroxy-2-iodo-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 11360131 |
| Molecular Formula | C15H13IO2 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | (2R,3R)-3-hydroxy-2-iodo-1,3-diphenylpropan-1-one |
| SMILES | O=C(c1ccccc1)[C@H](I)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H13IO2/c16-13(14(17)11-7-3-1-4-8-11)15(18)12-9-5-2-6-10-12/h1-10,13-14,17H/t13-,14-/m1/s1 |
| InChIKey | MQWKHRIGUSLOOO-ZIAGYGMSSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|