C18H19IO2 — CID 102014027
(2R,3S)-2-[(R)-hydroxy(phenyl)methyl]-4-iodo-3-methyl-1-phenylbutan-1-one (PubChem CID 102014027) has the molecular formula C18H19IO2 and a molecular weight of 394.25 g/mol. Its IUPAC name is (2R,3S)-2-[(R)-hydroxy(phenyl)methyl]-4-iodo-3-methyl-1-phenylbutan-1-one.
| Compound Name | (2R,3S)-2-[(R)-hydroxy(phenyl)methyl]-4-iodo-3-methyl-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 102014027 |
| Molecular Formula | C18H19IO2 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | (2R,3S)-2-[(R)-hydroxy(phenyl)methyl]-4-iodo-3-methyl-1-phenylbutan-1-one |
| SMILES | C[C@H](CI)[C@@H](C(=O)c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H19IO2/c1-13(12-19)16(17(20)14-8-4-2-5-9-14)18(21)15-10-6-3-7-11-15/h2-11,13,16-17,20H,12H2,1H3/t13-,16-,17+/m1/s1 |
| InChIKey | REVGQQNGFJXOLI-XYPHTWIQSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|