C10H9IO4 — CID 134992878
(3S,4S)-4-hydroxy-3-iodo-2-oxo-4-phenylbutanoic acid (PubChem CID 134992878) has the molecular formula C10H9IO4 and a molecular weight of 320.08 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-3-iodo-2-oxo-4-phenylbutanoic acid.
| Compound Name | (3S,4S)-4-hydroxy-3-iodo-2-oxo-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 134992878 |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | (3S,4S)-4-hydroxy-3-iodo-2-oxo-4-phenylbutanoic acid |
| SMILES | O=C(O)C(=O)[C@@H](I)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C10H9IO4/c11-7(9(13)10(14)15)8(12)6-4-2-1-3-5-6/h1-5,7-8,12H,(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | AKXHLGLDIOAQIW-YUMQZZPRSA-N |
| XLogP | 1.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|