C21H20O8 — CID 141228863
(3R,4R,5R)-4-benzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione (PubChem CID 141228863) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is (3R,4R,5R)-4-benzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione.
| Compound Name | (3R,4R,5R)-4-benzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione |
|---|---|
| PubChem CID | 141228863 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (3R,4R,5R)-4-benzoyl-2,3,4,5-tetrahydroxy-1-phenyloctane-1,6,7-trione |
| SMILES | CC(=O)C(=O)[C@H](O)[C@@](O)(C(=O)c1ccccc1)[C@H](O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O8/c1-12(22)15(23)19(27)21(29,18(26)14-10-6-3-7-11-14)20(28)17(25)16(24)13-8-4-2-5-9-13/h2-11,17,19-20,25,27-29H,1H3/t17?,19-,20+,21-/m0/s1 |
| InChIKey | SDHOKLSGAUFWTO-KRIYCRJKSA-N |
| XLogP | -0.28 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|