C14H13NO2 — CID 7016003
(2S)-2-(hydroxyamino)-1,2-diphenylethanone (PubChem CID 7016003) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2S)-2-(hydroxyamino)-1,2-diphenylethanone.
| Compound Name | (2S)-2-(hydroxyamino)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 7016003 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (2S)-2-(hydroxyamino)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)[C@@H](NO)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11/h1-10,13,15,17H/t13-/m0/s1 |
| InChIKey | VVEODXUGGAEFIQ-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|