C21H19NO — CID 36689295
(2S)-2-(4-methylanilino)-1,2-diphenylethanone (PubChem CID 36689295) has the molecular formula C21H19NO and a molecular weight of 301.39 g/mol. Its IUPAC name is (2S)-2-(4-methylanilino)-1,2-diphenylethanone.
| Compound Name | (2S)-2-(4-methylanilino)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 36689295 |
| Molecular Formula | C21H19NO |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2S)-2-(4-methylanilino)-1,2-diphenylethanone |
| SMILES | Cc1ccc(N[C@H](C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO/c1-16-12-14-19(15-13-16)22-20(17-8-4-2-5-9-17)21(23)18-10-6-3-7-11-18/h2-15,20,22H,1H3/t20-/m0/s1 |
| InChIKey | OKDKHOBYMXHNMN-FQEVSTJZSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |