C23H24N2O — CID 7778075
(2R)-N-(2,5-dimethylphenyl)-2-(4-methylanilino)-2-phenylacetamide (PubChem CID 7778075) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is (2R)-N-(2,5-dimethylphenyl)-2-(4-methylanilino)-2-phenylacetamide.
| Compound Name | (2R)-N-(2,5-dimethylphenyl)-2-(4-methylanilino)-2-phenylacetamide |
|---|---|
| PubChem CID | 7778075 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2R)-N-(2,5-dimethylphenyl)-2-(4-methylanilino)-2-phenylacetamide |
| SMILES | Cc1ccc(N[C@@H](C(=O)Nc2cc(C)ccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-16-10-13-20(14-11-16)24-22(19-7-5-4-6-8-19)23(26)25-21-15-17(2)9-12-18(21)3/h4-15,22,24H,1-3H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | WFLWBVUODCEFJK-JOCHJYFZSA-N |
| XLogP | 5.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |