C27H24NO2P — CID 101360122
2-(diphenylphosphorylamino)-2-(4-methylphenyl)-1-phenylethanone (PubChem CID 101360122) has the molecular formula C27H24NO2P and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-(diphenylphosphorylamino)-2-(4-methylphenyl)-1-phenylethanone.
| Compound Name | 2-(diphenylphosphorylamino)-2-(4-methylphenyl)-1-phenylethanone |
|---|---|
| PubChem CID | 101360122 |
| Molecular Formula | C27H24NO2P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-(diphenylphosphorylamino)-2-(4-methylphenyl)-1-phenylethanone |
| SMILES | Cc1ccc(C(NP(=O)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24NO2P/c1-21-17-19-22(20-18-21)26(27(29)23-11-5-2-6-12-23)28-31(30,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-20,26H,1H3,(H,28,30) |
| InChIKey | MJRGJXLPXJYLNH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|