C23H21FNO3P — CID 11407198
methyl 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]prop-2-enoate (PubChem CID 11407198) has the molecular formula C23H21FNO3P and a molecular weight of 409.40 g/mol. Its IUPAC name is methyl 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]prop-2-enoate.
| Compound Name | methyl 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11407198 |
| Molecular Formula | C23H21FNO3P |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | methyl 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FNO3P/c1-17(23(26)28-2)22(18-13-15-19(24)16-14-18)25-29(27,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,22H,1H2,2H3,(H,25,27) |
| InChIKey | CKLDXSPHCILBMY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|