C24H25FNO2P — CID 132551523
2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]-3-methylbut-3-en-1-ol (PubChem CID 132551523) has the molecular formula C24H25FNO2P and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]-3-methylbut-3-en-1-ol.
| Compound Name | 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 132551523 |
| Molecular Formula | C24H25FNO2P |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[(diphenylphosphorylamino)-(4-fluorophenyl)methyl]-3-methylbut-3-en-1-ol |
| SMILES | C=C(C)C(CO)C(NP(=O)(c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FNO2P/c1-18(2)23(17-27)24(19-13-15-20(25)16-14-19)26-29(28,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-16,23-24,27H,1,17H2,2H3,(H,26,28) |
| InChIKey | LOBXBDXPBIHFIL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|