C34H33N2O2P — CID 163522190
(1R,2R)-N-diphenylphosphoryl-N'-[(4-methoxyphenyl)methyl]-1,2-diphenylethane-1,2-diamine (PubChem CID 163522190) has the molecular formula C34H33N2O2P and a molecular weight of 532.62 g/mol. Its IUPAC name is (1R,2R)-N-diphenylphosphoryl-N'-[(4-methoxyphenyl)methyl]-1,2-diphenylethane-1,2-diamine.
| Compound Name | (1R,2R)-N-diphenylphosphoryl-N'-[(4-methoxyphenyl)methyl]-1,2-diphenylethane-1,2-diamine |
|---|---|
| PubChem CID | 163522190 |
| Molecular Formula | C34H33N2O2P |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (1R,2R)-N-diphenylphosphoryl-N'-[(4-methoxyphenyl)methyl]-1,2-diphenylethane-1,2-diamine |
| SMILES | COc1ccc(CN[C@H](c2ccccc2)[C@H](NP(=O)(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H33N2O2P/c1-38-30-24-22-27(23-25-30)26-35-33(28-14-6-2-7-15-28)34(29-16-8-3-9-17-29)36-39(37,31-18-10-4-11-19-31)32-20-12-5-13-21-32/h2-25,33-35H,26H2,1H3,(H,36,37)/t33-,34-/m1/s1 |
| InChIKey | DLUDVKPGQZDPFE-KKLWWLSJSA-N |
| XLogP | 6.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|