C30H29N2O2P — CID 100962663
(2S,4S)-N-diphenylphosphoryl-4-isocyano-4-(4-methoxyphenyl)-1-phenylbutan-2-amine (PubChem CID 100962663) has the molecular formula C30H29N2O2P and a molecular weight of 480.55 g/mol. Its IUPAC name is (2S,4S)-N-diphenylphosphoryl-4-isocyano-4-(4-methoxyphenyl)-1-phenylbutan-2-amine.
| Compound Name | (2S,4S)-N-diphenylphosphoryl-4-isocyano-4-(4-methoxyphenyl)-1-phenylbutan-2-amine |
|---|---|
| PubChem CID | 100962663 |
| Molecular Formula | C30H29N2O2P |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | (2S,4S)-N-diphenylphosphoryl-4-isocyano-4-(4-methoxyphenyl)-1-phenylbutan-2-amine |
| SMILES | [C-]#[N+][C@@H](C[C@H](Cc1ccccc1)NP(=O)(c1ccccc1)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H29N2O2P/c1-31-30(25-18-20-27(34-2)21-19-25)23-26(22-24-12-6-3-7-13-24)32-35(33,28-14-8-4-9-15-28)29-16-10-5-11-17-29/h3-21,26,30H,22-23H2,2H3,(H,32,33)/t26-,30-/m0/s1 |
| InChIKey | XQQPFGFKFCYJRX-YZNIXAGQSA-N |
| XLogP | 6.18 |
| TPSA | 42.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|