C28H24NO2P — CID 101481551
(1R)-N-diphenylphosphoryl-1-(4-methoxyphenyl)-3-phenylprop-2-yn-1-amine (PubChem CID 101481551) has the molecular formula C28H24NO2P and a molecular weight of 437.48 g/mol. Its IUPAC name is (1R)-N-diphenylphosphoryl-1-(4-methoxyphenyl)-3-phenylprop-2-yn-1-amine.
| Compound Name | (1R)-N-diphenylphosphoryl-1-(4-methoxyphenyl)-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 101481551 |
| Molecular Formula | C28H24NO2P |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (1R)-N-diphenylphosphoryl-1-(4-methoxyphenyl)-3-phenylprop-2-yn-1-amine |
| SMILES | COc1ccc([C@H](C#Cc2ccccc2)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24NO2P/c1-31-25-20-18-24(19-21-25)28(22-17-23-11-5-2-6-12-23)29-32(30,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-16,18-21,28H,1H3,(H,29,30)/t28-/m0/s1 |
| InChIKey | JSNAFAPJUHLLDO-NDEPHWFRSA-N |
| XLogP | 5.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|