C29H31N2O2P — CID 100962675
(1S,3S)-3-N-diphenylphosphoryl-1-(4-methoxyphenyl)-4-phenylbutane-1,3-diamine (PubChem CID 100962675) has the molecular formula C29H31N2O2P and a molecular weight of 470.55 g/mol. Its IUPAC name is (1S,3S)-3-N-diphenylphosphoryl-1-(4-methoxyphenyl)-4-phenylbutane-1,3-diamine.
| Compound Name | (1S,3S)-3-N-diphenylphosphoryl-1-(4-methoxyphenyl)-4-phenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 100962675 |
| Molecular Formula | C29H31N2O2P |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (1S,3S)-3-N-diphenylphosphoryl-1-(4-methoxyphenyl)-4-phenylbutane-1,3-diamine |
| SMILES | COc1ccc([C@@H](N)C[C@H](Cc2ccccc2)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H31N2O2P/c1-33-26-19-17-24(18-20-26)29(30)22-25(21-23-11-5-2-6-12-23)31-34(32,27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-20,25,29H,21-22,30H2,1H3,(H,31,32)/t25-,29-/m0/s1 |
| InChIKey | SDKKVGHEHZSDNX-SVEHJYQDSA-N |
| XLogP | 5.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|