C23H26NOP — CID 14934133
(2R)-N-diphenylphosphoryl-1-phenylpentan-2-amine (PubChem CID 14934133) has the molecular formula C23H26NOP and a molecular weight of 363.44 g/mol. Its IUPAC name is (2R)-N-diphenylphosphoryl-1-phenylpentan-2-amine.
| Compound Name | (2R)-N-diphenylphosphoryl-1-phenylpentan-2-amine |
|---|---|
| PubChem CID | 14934133 |
| Molecular Formula | C23H26NOP |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (2R)-N-diphenylphosphoryl-1-phenylpentan-2-amine |
| SMILES | CCC[C@H](Cc1ccccc1)NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NOP/c1-2-12-21(19-20-13-6-3-7-14-20)24-26(25,22-15-8-4-9-16-22)23-17-10-5-11-18-23/h3-11,13-18,21H,2,12,19H2,1H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | GUQHCBAUTFWRIU-OAQYLSRUSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|