C12H17NO — CID 87974467
N-(1-phenylpentan-2-yl)formamide (PubChem CID 87974467) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(1-phenylpentan-2-yl)formamide.
| Compound Name | N-(1-phenylpentan-2-yl)formamide |
|---|---|
| PubChem CID | 87974467 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(1-phenylpentan-2-yl)formamide |
| SMILES | CCCC(Cc1ccccc1)NC=O |
| InChI | InChI=1S/C12H17NO/c1-2-6-12(13-10-14)9-11-7-4-3-5-8-11/h3-5,7-8,10,12H,2,6,9H2,1H3,(H,13,14) |
| InChIKey | YOVDCUZOTWGEHX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|